C19H15NO5 — CID 19185797
[3-(ethylcarbamoyl)-2-oxochromen-7-yl] benzoate (PubChem CID 19185797) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is [3-(ethylcarbamoyl)-2-oxochromen-7-yl] benzoate.
| Compound Name | [3-(ethylcarbamoyl)-2-oxochromen-7-yl] benzoate |
|---|---|
| PubChem CID | 19185797 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | [3-(ethylcarbamoyl)-2-oxochromen-7-yl] benzoate |
| SMILES | CCNC(=O)c1cc2ccc(OC(=O)c3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C19H15NO5/c1-2-20-17(21)15-10-13-8-9-14(11-16(13)25-19(15)23)24-18(22)12-6-4-3-5-7-12/h3-11H,2H2,1H3,(H,20,21) |
| InChIKey | OGAODQSKRWPJSL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|