C20H17NO5 — CID 19185805
[2-oxo-3-(propylcarbamoyl)chromen-7-yl] benzoate (PubChem CID 19185805) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is [2-oxo-3-(propylcarbamoyl)chromen-7-yl] benzoate.
| Compound Name | [2-oxo-3-(propylcarbamoyl)chromen-7-yl] benzoate |
|---|---|
| PubChem CID | 19185805 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [2-oxo-3-(propylcarbamoyl)chromen-7-yl] benzoate |
| SMILES | CCCNC(=O)c1cc2ccc(OC(=O)c3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C20H17NO5/c1-2-10-21-18(22)16-11-14-8-9-15(12-17(14)26-20(16)24)25-19(23)13-6-4-3-5-7-13/h3-9,11-12H,2,10H2,1H3,(H,21,22) |
| InChIKey | MVIUAAUXWIGRGZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|