C31H25NO7 — CID 19186075
[3-(cyclohexylcarbamoyl)-2-oxochromen-7-yl] 4-(2-oxo-2-phenylacetyl)benzoate (PubChem CID 19186075) has the molecular formula C31H25NO7 and a molecular weight of 523.54 g/mol. Its IUPAC name is [3-(cyclohexylcarbamoyl)-2-oxochromen-7-yl] 4-(2-oxo-2-phenylacetyl)benzoate.
| Compound Name | [3-(cyclohexylcarbamoyl)-2-oxochromen-7-yl] 4-(2-oxo-2-phenylacetyl)benzoate |
|---|---|
| PubChem CID | 19186075 |
| Molecular Formula | C31H25NO7 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | [3-(cyclohexylcarbamoyl)-2-oxochromen-7-yl] 4-(2-oxo-2-phenylacetyl)benzoate |
| SMILES | O=C(Oc1ccc2cc(C(=O)NC3CCCCC3)c(=O)oc2c1)c1ccc(C(=O)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H25NO7/c33-27(19-7-3-1-4-8-19)28(34)20-11-13-21(14-12-20)30(36)38-24-16-15-22-17-25(31(37)39-26(22)18-24)29(35)32-23-9-5-2-6-10-23/h1,3-4,7-8,11-18,23H,2,5-6,9-10H2,(H,32,35) |
| InChIKey | CTEPYARLYTZKKQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|