C25H22N2O7 — CID 19186307
[3-(cyclohexylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 19186307) has the molecular formula C25H22N2O7 and a molecular weight of 462.46 g/mol. Its IUPAC name is [3-(cyclohexylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [3-(cyclohexylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19186307 |
| Molecular Formula | C25H22N2O7 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | [3-(cyclohexylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Oc1ccc2cc(C(=O)NC3CCCCC3)c(=O)oc2c1 |
| InChI | InChI=1S/C25H22N2O7/c28-23(12-9-16-5-4-8-19(13-16)27(31)32)33-20-11-10-17-14-21(25(30)34-22(17)15-20)24(29)26-18-6-2-1-3-7-18/h4-5,8-15,18H,1-3,6-7H2,(H,26,29)/b12-9+ |
| InChIKey | TYVITBPSZALTBB-FMIVXFBMSA-N |
| XLogP | 4.38 |
| TPSA | 128.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|