C24H20ClNO6 — CID 19186289
[2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 19186289) has the molecular formula C24H20ClNO6 and a molecular weight of 453.88 g/mol. Its IUPAC name is [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19186289 |
| Molecular Formula | C24H20ClNO6 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)Oc1ccc2cc(C(=O)NCC3CCCO3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H20ClNO6/c25-17-7-3-15(4-8-17)5-10-22(27)31-18-9-6-16-12-20(24(29)32-21(16)13-18)23(28)26-14-19-2-1-11-30-19/h3-10,12-13,19H,1-2,11,14H2,(H,26,28)/b10-5+ |
| InChIKey | NGAQKQPUHOIXPI-BJMVGYQFSA-N |
| XLogP | 3.97 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|