C24H23NO7 — CID 19186964
[2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 2-(2-methylphenoxy)acetate (PubChem CID 19186964) has the molecular formula C24H23NO7 and a molecular weight of 437.45 g/mol. Its IUPAC name is [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 2-(2-methylphenoxy)acetate.
| Compound Name | [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 2-(2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 19186964 |
| Molecular Formula | C24H23NO7 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 2-(2-methylphenoxy)acetate |
| SMILES | Cc1ccccc1OCC(=O)Oc1ccc2cc(C(=O)NCC3CCCO3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H23NO7/c1-15-5-2-3-7-20(15)30-14-22(26)31-17-9-8-16-11-19(24(28)32-21(16)12-17)23(27)25-13-18-6-4-10-29-18/h2-3,5,7-9,11-12,18H,4,6,10,13-14H2,1H3,(H,25,27) |
| InChIKey | COYCKHVKVDEYAW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|