C23H20N2O9 — CID 19186848
[2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 2-(4-nitrophenoxy)acetate (PubChem CID 19186848) has the molecular formula C23H20N2O9 and a molecular weight of 468.42 g/mol. Its IUPAC name is [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 2-(4-nitrophenoxy)acetate.
| Compound Name | [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 2-(4-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 19186848 |
| Molecular Formula | C23H20N2O9 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 2-(4-nitrophenoxy)acetate |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)Oc1ccc2cc(C(=O)NCC3CCCO3)c(=O)oc2c1 |
| InChI | InChI=1S/C23H20N2O9/c26-21(13-32-16-7-4-15(5-8-16)25(29)30)33-17-6-3-14-10-19(23(28)34-20(14)11-17)22(27)24-12-18-2-1-9-31-18/h3-8,10-11,18H,1-2,9,12-13H2,(H,24,27) |
| InChIKey | VTKBSAHRDRMLHC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|