C24H23NO6 — CID 19185742
[2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 3-phenylpropanoate (PubChem CID 19185742) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 3-phenylpropanoate.
| Compound Name | [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 19185742 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [2-oxo-3-(oxolan-2-ylmethylcarbamoyl)chromen-7-yl] 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)Oc1ccc2cc(C(=O)NCC3CCCO3)c(=O)oc2c1 |
| InChI | InChI=1S/C24H23NO6/c26-22(11-8-16-5-2-1-3-6-16)30-18-10-9-17-13-20(24(28)31-21(17)14-18)23(27)25-15-19-7-4-12-29-19/h1-3,5-6,9-10,13-14,19H,4,7-8,11-12,15H2,(H,25,27) |
| InChIKey | ORDHGNSFDBSLNA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|