C23H15Cl2NO7 — CID 19180660
[3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] 2-(2,5-dichlorophenoxy)acetate (PubChem CID 19180660) has the molecular formula C23H15Cl2NO7 and a molecular weight of 488.28 g/mol. Its IUPAC name is [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] 2-(2,5-dichlorophenoxy)acetate.
| Compound Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] 2-(2,5-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 19180660 |
| Molecular Formula | C23H15Cl2NO7 |
| Molecular Weight | 488.28 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] 2-(2,5-dichlorophenoxy)acetate |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)Oc1ccc2cc(C(=O)NCc3ccco3)c(=O)oc2c1 |
| InChI | InChI=1S/C23H15Cl2NO7/c24-14-4-6-18(25)20(9-14)31-12-21(27)32-15-5-3-13-8-17(23(29)33-19(13)10-15)22(28)26-11-16-2-1-7-30-16/h1-10H,11-12H2,(H,26,28) |
| InChIKey | LEIAHNUHLCQVRV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.28 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|