C24H23BrO7 — CID 19180093
ethyl 7-[2-(4-bromo-2-tert-butylphenoxy)acetyl]oxy-2-oxochromene-3-carboxylate (PubChem CID 19180093) has the molecular formula C24H23BrO7 and a molecular weight of 503.35 g/mol. Its IUPAC name is ethyl 7-[2-(4-bromo-2-tert-butylphenoxy)acetyl]oxy-2-oxochromene-3-carboxylate.
| Compound Name | ethyl 7-[2-(4-bromo-2-tert-butylphenoxy)acetyl]oxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19180093 |
| Molecular Formula | C24H23BrO7 |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | ethyl 7-[2-(4-bromo-2-tert-butylphenoxy)acetyl]oxy-2-oxochromene-3-carboxylate |
| SMILES | CCOC(=O)c1cc2ccc(OC(=O)COc3ccc(Br)cc3C(C)(C)C)cc2oc1=O |
| InChI | InChI=1S/C24H23BrO7/c1-5-29-22(27)17-10-14-6-8-16(12-20(14)32-23(17)28)31-21(26)13-30-19-9-7-15(25)11-18(19)24(2,3)4/h6-12H,5,13H2,1-4H3 |
| InChIKey | USUQUEHURINEMY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|