C21H18O8 — CID 19181559
ethyl 7-(3,4-dimethoxybenzoyl)oxy-2-oxochromene-3-carboxylate (PubChem CID 19181559) has the molecular formula C21H18O8 and a molecular weight of 398.37 g/mol. Its IUPAC name is ethyl 7-(3,4-dimethoxybenzoyl)oxy-2-oxochromene-3-carboxylate.
| Compound Name | ethyl 7-(3,4-dimethoxybenzoyl)oxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19181559 |
| Molecular Formula | C21H18O8 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | ethyl 7-(3,4-dimethoxybenzoyl)oxy-2-oxochromene-3-carboxylate |
| SMILES | CCOC(=O)c1cc2ccc(OC(=O)c3ccc(OC)c(OC)c3)cc2oc1=O |
| InChI | InChI=1S/C21H18O8/c1-4-27-20(23)15-9-12-5-7-14(11-17(12)29-21(15)24)28-19(22)13-6-8-16(25-2)18(10-13)26-3/h5-11H,4H2,1-3H3 |
| InChIKey | SOUYMABPABHQEE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|