C19H14Cl2O5 — CID 19204595
ethyl 7-[(2,6-dichlorophenyl)methoxy]-2-oxochromene-3-carboxylate (PubChem CID 19204595) has the molecular formula C19H14Cl2O5 and a molecular weight of 393.22 g/mol. Its IUPAC name is ethyl 7-[(2,6-dichlorophenyl)methoxy]-2-oxochromene-3-carboxylate.
| Compound Name | ethyl 7-[(2,6-dichlorophenyl)methoxy]-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19204595 |
| Molecular Formula | C19H14Cl2O5 |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | ethyl 7-[(2,6-dichlorophenyl)methoxy]-2-oxochromene-3-carboxylate |
| SMILES | CCOC(=O)c1cc2ccc(OCc3c(Cl)cccc3Cl)cc2oc1=O |
| InChI | InChI=1S/C19H14Cl2O5/c1-2-24-18(22)13-8-11-6-7-12(9-17(11)26-19(13)23)25-10-14-15(20)4-3-5-16(14)21/h3-9H,2,10H2,1H3 |
| InChIKey | MFGXKRHWGLTTBL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|