C20H17NO7 — CID 19186836
(3-carbamoyl-2-oxochromen-7-yl) 2-(2-ethoxyphenoxy)acetate (PubChem CID 19186836) has the molecular formula C20H17NO7 and a molecular weight of 383.36 g/mol. Its IUPAC name is (3-carbamoyl-2-oxochromen-7-yl) 2-(2-ethoxyphenoxy)acetate.
| Compound Name | (3-carbamoyl-2-oxochromen-7-yl) 2-(2-ethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 19186836 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | (3-carbamoyl-2-oxochromen-7-yl) 2-(2-ethoxyphenoxy)acetate |
| SMILES | CCOc1ccccc1OCC(=O)Oc1ccc2cc(C(N)=O)c(=O)oc2c1 |
| InChI | InChI=1S/C20H17NO7/c1-2-25-15-5-3-4-6-16(15)26-11-18(22)27-13-8-7-12-9-14(19(21)23)20(24)28-17(12)10-13/h3-10H,2,11H2,1H3,(H2,21,23) |
| InChIKey | ZCUGGMVHWFFBEB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|