C23H15ClN2O5 — CID 19186540
[2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] (E)-3-(4-chlorophenyl)-2-cyanoprop-2-enoate (PubChem CID 19186540) has the molecular formula C23H15ClN2O5 and a molecular weight of 434.84 g/mol. Its IUPAC name is [2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] (E)-3-(4-chlorophenyl)-2-cyanoprop-2-enoate.
| Compound Name | [2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] (E)-3-(4-chlorophenyl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 19186540 |
| Molecular Formula | C23H15ClN2O5 |
| Molecular Weight | 434.84 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | [2-oxo-3-(prop-2-enylcarbamoyl)chromen-7-yl] (E)-3-(4-chlorophenyl)-2-cyanoprop-2-enoate |
| SMILES | C=CCNC(=O)c1cc2ccc(OC(=O)/C(C#N)=C/c3ccc(Cl)cc3)cc2oc1=O |
| InChI | InChI=1S/C23H15ClN2O5/c1-2-9-26-21(27)19-11-15-5-8-18(12-20(15)31-23(19)29)30-22(28)16(13-25)10-14-3-6-17(24)7-4-14/h2-8,10-12H,1,9H2,(H,26,27)/b16-10+ |
| InChIKey | JVJKZFUSRMEZEF-MHWRWJLKSA-N |
| XLogP | 3.87 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|