C25H21NO5 — CID 8926973
(4-methoxyphenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 8926973) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | (4-methoxyphenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 8926973 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (4-methoxyphenyl)methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | COc1ccc(COC(=O)[C@H](Cc2ccccc2)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C25H21NO5/c1-30-19-13-11-18(12-14-19)16-31-25(29)22(15-17-7-3-2-4-8-17)26-23(27)20-9-5-6-10-21(20)24(26)28/h2-14,22H,15-16H2,1H3/t22-/m0/s1 |
| InChIKey | TYLJUZSWIDREPW-QFIPXVFZSA-N |
| XLogP | 3.65 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|