C26H21NO7 — CID 1216664
[2-(4-methoxyphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(4-hydroxyphenyl)propanoate (PubChem CID 1216664) has the molecular formula C26H21NO7 and a molecular weight of 459.45 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(4-hydroxyphenyl)propanoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 1216664 |
| Molecular Formula | C26H21NO7 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-(4-hydroxyphenyl)propanoate |
| SMILES | COc1ccc(C(=O)COC(=O)[C@@H](Cc2ccc(O)cc2)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H21NO7/c1-33-19-12-8-17(9-13-19)23(29)15-34-26(32)22(14-16-6-10-18(28)11-7-16)27-24(30)20-4-2-3-5-21(20)25(27)31/h2-13,22,28H,14-15H2,1H3/t22-/m1/s1 |
| InChIKey | JLYVODPFTMQSHA-JOCHJYFZSA-N |
| XLogP | 3.03 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|