C24H19NO6 — CID 23827826
[2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 23827826) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 23827826 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-(6-methoxynaphthalen-2-yl)-2-oxoethyl] 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | COc1ccc2cc(C(=O)COC(=O)C(C)N3C(=O)c4ccccc4C3=O)ccc2c1 |
| InChI | InChI=1S/C24H19NO6/c1-14(25-22(27)19-5-3-4-6-20(19)23(25)28)24(29)31-13-21(26)17-8-7-16-12-18(30-2)10-9-15(16)11-17/h3-12,14H,13H2,1-2H3 |
| InChIKey | WMSBOOICTDKEEP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|