C29H25NO8 — CID 19646025
[4-[2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]oxyacetyl]phenyl] 3-methoxybenzoate (PubChem CID 19646025) has the molecular formula C29H25NO8 and a molecular weight of 515.52 g/mol. Its IUPAC name is [4-[2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]oxyacetyl]phenyl] 3-methoxybenzoate.
| Compound Name | [4-[2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]oxyacetyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 19646025 |
| Molecular Formula | C29H25NO8 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | [4-[2-[(2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoyl]oxyacetyl]phenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C(=O)COC(=O)[C@H](C(C)C)N3C(=O)c4ccccc4C3=O)cc2)c1 |
| InChI | InChI=1S/C29H25NO8/c1-17(2)25(30-26(32)22-9-4-5-10-23(22)27(30)33)29(35)37-16-24(31)18-11-13-20(14-12-18)38-28(34)19-7-6-8-21(15-19)36-3/h4-15,17,25H,16H2,1-3H3/t25-/m0/s1 |
| InChIKey | XOHMXMTXRZETJM-VWLOTQADSA-N |
| XLogP | 3.96 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|