C22H21NO5 — CID 8942442
phenacyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate (PubChem CID 8942442) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is phenacyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate.
| Compound Name | phenacyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 8942442 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | phenacyl (2S,3S)-2-(1,3-dioxoisoindol-2-yl)-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OCC(=O)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H21NO5/c1-3-14(2)19(22(27)28-13-18(24)15-9-5-4-6-10-15)23-20(25)16-11-7-8-12-17(16)21(23)26/h4-12,14,19H,3,13H2,1-2H3/t14-,19-/m0/s1 |
| InChIKey | NDHVYBKNVAVOBK-LIRRHRJNSA-N |
| XLogP | 3.12 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|