C25H27NO5 — CID 22748005
[2-(4-tert-butylphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 22748005) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
| Compound Name | [2-(4-tert-butylphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 22748005 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [2-(4-tert-butylphenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | CC(C)[C@H](C(=O)OCC(=O)c1ccc(C(C)(C)C)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H27NO5/c1-15(2)21(26-22(28)18-8-6-7-9-19(18)23(26)29)24(30)31-14-20(27)16-10-12-17(13-11-16)25(3,4)5/h6-13,15,21H,14H2,1-5H3/t21-/m1/s1 |
| InChIKey | YKKHYMHNBIVKLU-OAQYLSRUSA-N |
| XLogP | 4.03 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|