C30H24O6 — CID 3910563
[4-[2-(2,2-diphenylacetyl)oxyacetyl]phenyl] 3-methoxybenzoate (PubChem CID 3910563) has the molecular formula C30H24O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is [4-[2-(2,2-diphenylacetyl)oxyacetyl]phenyl] 3-methoxybenzoate.
| Compound Name | [4-[2-(2,2-diphenylacetyl)oxyacetyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 3910563 |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [4-[2-(2,2-diphenylacetyl)oxyacetyl]phenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C(=O)COC(=O)C(c3ccccc3)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C30H24O6/c1-34-26-14-8-13-24(19-26)29(32)36-25-17-15-21(16-18-25)27(31)20-35-30(33)28(22-9-4-2-5-10-22)23-11-6-3-7-12-23/h2-19,28H,20H2,1H3 |
| InChIKey | HYXZEOIRQSHPPQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|