C22H20O6 — CID 4239385
[4-(2-hexa-2,4-dienoyloxyacetyl)phenyl] 3-methoxybenzoate (PubChem CID 4239385) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is [4-(2-hexa-2,4-dienoyloxyacetyl)phenyl] 3-methoxybenzoate.
| Compound Name | [4-(2-hexa-2,4-dienoyloxyacetyl)phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 4239385 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [4-(2-hexa-2,4-dienoyloxyacetyl)phenyl] 3-methoxybenzoate |
| SMILES | CC=CC=CC(=O)OCC(=O)c1ccc(OC(=O)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C22H20O6/c1-3-4-5-9-21(24)27-15-20(23)16-10-12-18(13-11-16)28-22(25)17-7-6-8-19(14-17)26-2/h3-14H,15H2,1-2H3 |
| InChIKey | RYIZQUVVMQSTGL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|