C20H17NO5 — CID 19170750
(4-propanoylphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 19170750) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is (4-propanoylphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (4-propanoylphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 19170750 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (4-propanoylphenyl) 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CCC(=O)c1ccc(OC(=O)C(C)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H17NO5/c1-3-17(22)13-8-10-14(11-9-13)26-20(25)12(2)21-18(23)15-6-4-5-7-16(15)19(21)24/h4-12H,3H2,1-2H3 |
| InChIKey | NSHWBYSTFPABLB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|