C18H13NO6 — CID 2999838
1,3-benzodioxol-5-yl 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2999838) has the molecular formula C18H13NO6 and a molecular weight of 339.30 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | 1,3-benzodioxol-5-yl 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 2999838 |
| Molecular Formula | C18H13NO6 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 1,3-benzodioxol-5-yl 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)Oc1ccc2c(c1)OCO2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H13NO6/c1-10(19-16(20)12-4-2-3-5-13(12)17(19)21)18(22)25-11-6-7-14-15(8-11)24-9-23-14/h2-8,10H,9H2,1H3 |
| InChIKey | YXZGFOVPQXTMMF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|