C20H17NO6S — CID 2401440
1,3-benzodioxol-5-yl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate (PubChem CID 2401440) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate.
| Compound Name | 1,3-benzodioxol-5-yl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2401440 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 1,3-benzodioxol-5-yl (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](C(=O)Oc1ccc2c(c1)OCO2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H17NO6S/c1-28-9-8-15(21-18(22)13-4-2-3-5-14(13)19(21)23)20(24)27-12-6-7-16-17(10-12)26-11-25-16/h2-7,10,15H,8-9,11H2,1H3/t15-/m0/s1 |
| InChIKey | HYDKBMMYTMRLEO-HNNXBMFYSA-N |
| XLogP | 2.74 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|