C17H17NO6S — CID 2404854
[(3S)-2-oxooxolan-3-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate (PubChem CID 2404854) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2404854 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] (2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](C(=O)O[C@H]1CCOC1=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H17NO6S/c1-25-9-7-12(16(21)24-13-6-8-23-17(13)22)18-14(19)10-4-2-3-5-11(10)15(18)20/h2-5,12-13H,6-9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | BZKFGRNXEYERHW-OLZOCXBDSA-N |
| XLogP | 1.26 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|