C18H19NO6 — CID 9408568
[(3S)-2-oxooxolan-3-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 9408568) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 9408568 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)O[C@H]1CCOC1=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H19NO6/c1-10(2)9-13(17(22)25-14-7-8-24-18(14)23)19-15(20)11-5-3-4-6-12(11)16(19)21/h3-6,10,13-14H,7-9H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | KMGKJRTZLWGLSM-KBPBESRZSA-N |
| XLogP | 1.56 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|