C19H22N2O5S — CID 25483428
methyl (2R)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]pyrrolidine-2-carboxylate (PubChem CID 25483428) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is methyl (2R)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 25483428 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | methyl (2R)-1-[(2R)-2-(1,3-dioxoisoindol-2-yl)-4-methylsulfanylbutanoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN1C(=O)[C@@H](CCSC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H22N2O5S/c1-26-19(25)15-8-5-10-20(15)18(24)14(9-11-27-2)21-16(22)12-6-3-4-7-13(12)17(21)23/h3-4,6-7,14-15H,5,8-11H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | MYNMTIDEZOSVMH-HUUCEWRRSA-N |
| XLogP | 1.57 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|