C19H21N3O7 — CID 11025830
(4S)-4-(1,3-dioxoisoindol-2-yl)-5-(6-methoxycarbonyldiazinan-1-yl)-5-oxopentanoic acid (PubChem CID 11025830) has the molecular formula C19H21N3O7 and a molecular weight of 403.39 g/mol. Its IUPAC name is (4S)-4-(1,3-dioxoisoindol-2-yl)-5-(6-methoxycarbonyldiazinan-1-yl)-5-oxopentanoic acid.
| Compound Name | (4S)-4-(1,3-dioxoisoindol-2-yl)-5-(6-methoxycarbonyldiazinan-1-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11025830 |
| Molecular Formula | C19H21N3O7 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (4S)-4-(1,3-dioxoisoindol-2-yl)-5-(6-methoxycarbonyldiazinan-1-yl)-5-oxopentanoic acid |
| SMILES | COC(=O)C1CCCNN1C(=O)[C@H](CCC(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H21N3O7/c1-29-19(28)14-7-4-10-20-22(14)18(27)13(8-9-15(23)24)21-16(25)11-5-2-3-6-12(11)17(21)26/h2-3,5-6,13-14,20H,4,7-10H2,1H3,(H,23,24)/t13-,14?/m0/s1 |
| InChIKey | PDBRVXJFSZHLRZ-LSLKUGRBSA-N |
| XLogP | 0.18 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|