C17H20N4O4 — CID 59947320
2-[(2S)-1-[(6S)-6-acetyldiazinan-1-yl]-3-amino-1-oxopropan-2-yl]isoindole-1,3-dione (PubChem CID 59947320) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-[(2S)-1-[(6S)-6-acetyldiazinan-1-yl]-3-amino-1-oxopropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-1-[(6S)-6-acetyldiazinan-1-yl]-3-amino-1-oxopropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59947320 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-[(2S)-1-[(6S)-6-acetyldiazinan-1-yl]-3-amino-1-oxopropan-2-yl]isoindole-1,3-dione |
| SMILES | CC(=O)[C@@H]1CCCNN1C(=O)[C@H](CN)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H20N4O4/c1-10(22)13-7-4-8-19-21(13)17(25)14(9-18)20-15(23)11-5-2-3-6-12(11)16(20)24/h2-3,5-6,13-14,19H,4,7-9,18H2,1H3/t13-,14-/m0/s1 |
| InChIKey | HBWZHVUSVCMOFJ-KBPBESRZSA-N |
| XLogP | -0.31 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|