C23H23NO4 — CID 7610467
cyclohexyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 7610467) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is cyclohexyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | cyclohexyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 7610467 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | cyclohexyl (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | O=C(OC1CCCCC1)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H23NO4/c25-21-18-13-7-8-14-19(18)22(26)24(21)20(15-16-9-3-1-4-10-16)23(27)28-17-11-5-2-6-12-17/h1,3-4,7-10,13-14,17,20H,2,5-6,11-12,15H2/t20-/m0/s1 |
| InChIKey | LOBSHZGUNYMBJM-FQEVSTJZSA-N |
| XLogP | 3.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|