C26H28N2O3 — CID 23376206
2-[(2R)-1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione (PubChem CID 23376206) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[(2R)-1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R)-1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23376206 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[(2R)-1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-1-oxo-3-phenylpropan-2-yl]isoindole-1,3-dione |
| SMILES | O=C([C@@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C26H28N2O3/c29-24-20-13-5-6-14-21(20)25(30)28(24)23(17-18-9-2-1-3-10-18)26(31)27-16-8-12-19-11-4-7-15-22(19)27/h1-3,5-6,9-10,13-14,19,22-23H,4,7-8,11-12,15-17H2/t19-,22-,23-/m1/s1 |
| InChIKey | DJPJWNAYRVXDSJ-UEVCKROQSA-N |
| XLogP | 4.08 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|