C24H26N2O3 — CID 2666747
(2S)-N-(cyclohexylmethyl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide (PubChem CID 2666747) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is (2S)-N-(cyclohexylmethyl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide.
| Compound Name | (2S)-N-(cyclohexylmethyl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 2666747 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (2S)-N-(cyclohexylmethyl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
| SMILES | O=C(NCC1CCCCC1)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H26N2O3/c27-22(25-16-18-11-5-2-6-12-18)21(15-17-9-3-1-4-10-17)26-23(28)19-13-7-8-14-20(19)24(26)29/h1,3-4,7-10,13-14,18,21H,2,5-6,11-12,15-16H2,(H,25,27)/t21-/m0/s1 |
| InChIKey | SCKVNTJOCUFJAL-NRFANRHFSA-N |
| XLogP | 3.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|