C16H24N2O2 — CID 56998596
(3S)-3-amino-N-(cyclopentylmethyl)-2-hydroxy-4-phenylbutanamide (PubChem CID 56998596) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3S)-3-amino-N-(cyclopentylmethyl)-2-hydroxy-4-phenylbutanamide.
| Compound Name | (3S)-3-amino-N-(cyclopentylmethyl)-2-hydroxy-4-phenylbutanamide |
|---|---|
| PubChem CID | 56998596 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (3S)-3-amino-N-(cyclopentylmethyl)-2-hydroxy-4-phenylbutanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(O)C(=O)NCC1CCCC1 |
| InChI | InChI=1S/C16H24N2O2/c17-14(10-12-6-2-1-3-7-12)15(19)16(20)18-11-13-8-4-5-9-13/h1-3,6-7,13-15,19H,4-5,8-11,17H2,(H,18,20)/t14-,15?/m0/s1 |
| InChIKey | FEWAWCBDPUKELJ-MLCCFXAWSA-N |
| XLogP | 1.22 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |