C20H31N3O4 — CID 87998409
(3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[2-oxo-2-(2-phenylethylamino)ethoxy]butanamide (PubChem CID 87998409) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[2-oxo-2-(2-phenylethylamino)ethoxy]butanamide.
| Compound Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[2-oxo-2-(2-phenylethylamino)ethoxy]butanamide |
|---|---|
| PubChem CID | 87998409 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-2-hydroxy-N-[2-oxo-2-(2-phenylethylamino)ethoxy]butanamide |
| SMILES | N[C@H](CC1CCCCC1)C(O)C(=O)NOCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H31N3O4/c21-17(13-16-9-5-2-6-10-16)19(25)20(26)23-27-14-18(24)22-12-11-15-7-3-1-4-8-15/h1,3-4,7-8,16-17,19,25H,2,5-6,9-14,21H2,(H,22,24)(H,23,26)/t17-,19?/m1/s1 |
| InChIKey | SLFSLIVXDWGLJM-DUSLRRAJSA-N |
| XLogP | 1.05 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|