C17H26N2O3 — CID 87998484
(3R)-3-amino-5-cyclohexyl-2-hydroxy-N-phenoxypentanamide (PubChem CID 87998484) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (3R)-3-amino-5-cyclohexyl-2-hydroxy-N-phenoxypentanamide.
| Compound Name | (3R)-3-amino-5-cyclohexyl-2-hydroxy-N-phenoxypentanamide |
|---|---|
| PubChem CID | 87998484 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (3R)-3-amino-5-cyclohexyl-2-hydroxy-N-phenoxypentanamide |
| SMILES | N[C@H](CCC1CCCCC1)C(O)C(=O)NOc1ccccc1 |
| InChI | InChI=1S/C17H26N2O3/c18-15(12-11-13-7-3-1-4-8-13)16(20)17(21)19-22-14-9-5-2-6-10-14/h2,5-6,9-10,13,15-16,20H,1,3-4,7-8,11-12,18H2,(H,19,21)/t15-,16?/m1/s1 |
| InChIKey | JBBUVCSCQWCDHZ-AAFJCEBUSA-N |
| XLogP | 2.15 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|