C12H15F3N2O2 — CID 69029068
(3S)-3-amino-2-hydroxy-4-phenyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 69029068) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is (3S)-3-amino-2-hydroxy-4-phenyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (3S)-3-amino-2-hydroxy-4-phenyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 69029068 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (3S)-3-amino-2-hydroxy-4-phenyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2/c13-12(14,15)7-17-11(19)10(18)9(16)6-8-4-2-1-3-5-8/h1-5,9-10,18H,6-7,16H2,(H,17,19)/t9-,10?/m0/s1 |
| InChIKey | WDIJUHINUHKHLQ-RGURZIINSA-N |
| XLogP | 0.60 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |