C10H14N2O2 — CID 57194593
(2S,3S)-3-amino-2-hydroxy-4-phenylbutanamide (PubChem CID 57194593) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (2S,3S)-3-amino-2-hydroxy-4-phenylbutanamide.
| Compound Name | (2S,3S)-3-amino-2-hydroxy-4-phenylbutanamide |
|---|---|
| PubChem CID | 57194593 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (2S,3S)-3-amino-2-hydroxy-4-phenylbutanamide |
| SMILES | NC(=O)[C@@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C10H14N2O2/c11-8(9(13)10(12)14)6-7-4-2-1-3-5-7/h1-5,8-9,13H,6,11H2,(H2,12,14)/t8-,9-/m0/s1 |
| InChIKey | JAYYJZZOYTVNHH-IUCAKERBSA-N |
| XLogP | -0.60 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |