C12H18N2O3 — CID 57222497
(2S,3R)-3-amino-2-hydroxy-N-methoxy-N-methyl-4-phenylbutanamide (PubChem CID 57222497) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is (2S,3R)-3-amino-2-hydroxy-N-methoxy-N-methyl-4-phenylbutanamide.
| Compound Name | (2S,3R)-3-amino-2-hydroxy-N-methoxy-N-methyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 57222497 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (2S,3R)-3-amino-2-hydroxy-N-methoxy-N-methyl-4-phenylbutanamide |
| SMILES | CON(C)C(=O)[C@@H](O)[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C12H18N2O3/c1-14(17-2)12(16)11(15)10(13)8-9-6-4-3-5-7-9/h3-7,10-11,15H,8,13H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | OWXXVFAFDNRKRB-MNOVXSKESA-N |
| XLogP | -0.06 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|