C11H15NO2 — CID 59897360
(3R,4S)-4-amino-3-hydroxy-5-phenylpentan-2-one (PubChem CID 59897360) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (3R,4S)-4-amino-3-hydroxy-5-phenylpentan-2-one.
| Compound Name | (3R,4S)-4-amino-3-hydroxy-5-phenylpentan-2-one |
|---|---|
| PubChem CID | 59897360 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (3R,4S)-4-amino-3-hydroxy-5-phenylpentan-2-one |
| SMILES | CC(=O)[C@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-8(13)11(14)10(12)7-9-5-3-2-4-6-9/h2-6,10-11,14H,7,12H2,1H3/t10-,11-/m0/s1 |
| InChIKey | GJPFHRUTWWFJAS-QWRGUYRKSA-N |
| XLogP | 0.51 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |