C21H27ClN2O5 — CID 86584507
benzyl 2-[(2R,3S)-3-amino-1-[methoxy(methyl)amino]-1-oxo-4-phenylbutan-2-yl]oxyacetate;hydrochloride (PubChem CID 86584507) has the molecular formula C21H27ClN2O5 and a molecular weight of 422.91 g/mol. Its IUPAC name is benzyl 2-[(2R,3S)-3-amino-1-[methoxy(methyl)amino]-1-oxo-4-phenylbutan-2-yl]oxyacetate;hydrochloride.
| Compound Name | benzyl 2-[(2R,3S)-3-amino-1-[methoxy(methyl)amino]-1-oxo-4-phenylbutan-2-yl]oxyacetate;hydrochloride |
|---|---|
| PubChem CID | 86584507 |
| Molecular Formula | C21H27ClN2O5 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | benzyl 2-[(2R,3S)-3-amino-1-[methoxy(methyl)amino]-1-oxo-4-phenylbutan-2-yl]oxyacetate;hydrochloride |
| SMILES | CON(C)C(=O)[C@H](OCC(=O)OCc1ccccc1)[C@@H](N)Cc1ccccc1.Cl |
| InChI | InChI=1S/C21H26N2O5.ClH/c1-23(26-2)21(25)20(18(22)13-16-9-5-3-6-10-16)28-15-19(24)27-14-17-11-7-4-8-12-17;/h3-12,18,20H,13-15,22H2,1-2H3;1H/t18-,20+;/m0./s1 |
| InChIKey | JNHSPFKMALPHFQ-VKLKMBQZSA-N |
| XLogP | 2.13 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|