C13H18N2O4 — CID 73292966
benzyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo(1,2,3-13C3)propan-2-yl]carbamate (PubChem CID 73292966) has the molecular formula C13H18N2O4 and a molecular weight of 270.27 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo(1,2,3-13C3)propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo(1,2,3-13C3)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 73292966 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | benzyl N-[(2S)-1-[methoxy(methyl)amino]-1-oxo(1,2,3-13C3)propan-2-yl]carbamate |
| SMILES | CON(C)[13C](=O)[13C@H]([13CH3])[15NH]C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H18N2O4/c1-10(12(16)15(2)18-3)14-13(17)19-9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3,(H,14,17)/t10-/m0/s1/i1+1,10+1,12+1,14+1 |
| InChIKey | JJWLCBIYQXRMNO-NCRHDSBQSA-N |
| XLogP | 1.32 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|