C11H13F3N2O2 — CID 153385822
3-amino-2-hydroxy-4-[4-(trifluoromethyl)phenyl]butanamide (PubChem CID 153385822) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 3-amino-2-hydroxy-4-[4-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 3-amino-2-hydroxy-4-[4-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 153385822 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3-amino-2-hydroxy-4-[4-(trifluoromethyl)phenyl]butanamide |
| SMILES | NC(=O)C(O)C(N)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2O2/c12-11(13,14)7-3-1-6(2-4-7)5-8(15)9(17)10(16)18/h1-4,8-9,17H,5,15H2,(H2,16,18) |
| InChIKey | JCVLXBPYQOCKQK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |