C15H19F3N2O3 — CID 155783295
tert-butyl N-[1-amino-1-oxo-3-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate (PubChem CID 155783295) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is tert-butyl N-[1-amino-1-oxo-3-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-amino-1-oxo-3-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 155783295 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | tert-butyl N-[1-amino-1-oxo-3-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(C(F)(F)F)cc1)C(N)=O |
| InChI | InChI=1S/C15H19F3N2O3/c1-14(2,3)23-13(22)20-11(12(19)21)8-9-4-6-10(7-5-9)15(16,17)18/h4-7,11H,8H2,1-3H3,(H2,19,21)(H,20,22) |
| InChIKey | WNZGQWNQTSMUBI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |