C18H24N2O4 — CID 118260243
tert-butyl N-[(2S)-1-amino-3-(4-but-2-ynoxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 118260243) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-amino-3-(4-but-2-ynoxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-amino-3-(4-but-2-ynoxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 118260243 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-amino-3-(4-but-2-ynoxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)OC(C)(C)C)C(N)=O)cc1 |
| InChI | InChI=1S/C18H24N2O4/c1-5-6-11-23-14-9-7-13(8-10-14)12-15(16(19)21)20-17(22)24-18(2,3)4/h7-10,15H,11-12H2,1-4H3,(H2,19,21)(H,20,22)/t15-/m0/s1 |
| InChIKey | LMTRYXNVQAIOOH-HNNXBMFYSA-N |
| XLogP | 2.01 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|