C21H28N2O6 — CID 118263479
methyl 2-[[(2S)-3-(4-but-2-ynoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetate (PubChem CID 118263479) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is methyl 2-[[(2S)-3-(4-but-2-ynoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2S)-3-(4-but-2-ynoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 118263479 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | methyl 2-[[(2S)-3-(4-but-2-ynoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]acetate |
| SMILES | CC#CCOc1ccc(C[C@H](NC(=O)OC(C)(C)C)C(=O)NCC(=O)OC)cc1 |
| InChI | InChI=1S/C21H28N2O6/c1-6-7-12-28-16-10-8-15(9-11-16)13-17(19(25)22-14-18(24)27-5)23-20(26)29-21(2,3)4/h8-11,17H,12-14H2,1-5H3,(H,22,25)(H,23,26)/t17-/m0/s1 |
| InChIKey | CYLKDZXLPKCZLT-KRWDZBQOSA-N |
| XLogP | 1.81 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|