C15H20F3NO2 — CID 143988423
tert-butyl N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate (PubChem CID 143988423) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 143988423 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | tert-butyl N-[1-[4-(trifluoromethyl)phenyl]propan-2-yl]carbamate |
| SMILES | CC(Cc1ccc(C(F)(F)F)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20F3NO2/c1-10(19-13(20)21-14(2,3)4)9-11-5-7-12(8-6-11)15(16,17)18/h5-8,10H,9H2,1-4H3,(H,19,20) |
| InChIKey | NHKGDHWETHICSZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |