C14H19F3N2O2 — CID 110027716
(2R)-2-[[2-hydroxy-3-[4-(trifluoromethyl)phenyl]propyl]-methylamino]propanamide (PubChem CID 110027716) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is (2R)-2-[[2-hydroxy-3-[4-(trifluoromethyl)phenyl]propyl]-methylamino]propanamide.
| Compound Name | (2R)-2-[[2-hydroxy-3-[4-(trifluoromethyl)phenyl]propyl]-methylamino]propanamide |
|---|---|
| PubChem CID | 110027716 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (2R)-2-[[2-hydroxy-3-[4-(trifluoromethyl)phenyl]propyl]-methylamino]propanamide |
| SMILES | C[C@H](C(N)=O)N(C)CC(O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-9(13(18)21)19(2)8-12(20)7-10-3-5-11(6-4-10)14(15,16)17/h3-6,9,12,20H,7-8H2,1-2H3,(H2,18,21)/t9-,12?/m1/s1 |
| InChIKey | PNYGOHMPIADUQU-PKEIRNPWSA-N |
| XLogP | 1.41 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |