C17H25F3O — CID 115791046
4,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]heptan-2-ol (PubChem CID 115791046) has the molecular formula C17H25F3O and a molecular weight of 302.38 g/mol. Its IUPAC name is 4,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]heptan-2-ol.
| Compound Name | 4,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]heptan-2-ol |
|---|---|
| PubChem CID | 115791046 |
| Molecular Formula | C17H25F3O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 4,6,6-trimethyl-1-[4-(trifluoromethyl)phenyl]heptan-2-ol |
| SMILES | CC(CC(O)Cc1ccc(C(F)(F)F)cc1)CC(C)(C)C |
| InChI | InChI=1S/C17H25F3O/c1-12(11-16(2,3)4)9-15(21)10-13-5-7-14(8-6-13)17(18,19)20/h5-8,12,15,21H,9-11H2,1-4H3 |
| InChIKey | NBPHQBCJBSJIPR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |