C13H17F3O2 — CID 103448650
3-methyl-1-[4-(trifluoromethyl)phenyl]pentane-2,3-diol (PubChem CID 103448650) has the molecular formula C13H17F3O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-methyl-1-[4-(trifluoromethyl)phenyl]pentane-2,3-diol.
| Compound Name | 3-methyl-1-[4-(trifluoromethyl)phenyl]pentane-2,3-diol |
|---|---|
| PubChem CID | 103448650 |
| Molecular Formula | C13H17F3O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 3-methyl-1-[4-(trifluoromethyl)phenyl]pentane-2,3-diol |
| SMILES | CCC(C)(O)C(O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3O2/c1-3-12(2,18)11(17)8-9-4-6-10(7-5-9)13(14,15)16/h4-7,11,17-18H,3,8H2,1-2H3 |
| InChIKey | WCEUDWPDTXNXHI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |